WormBase Tree Display for Molecule: WBMol:00004908
expand all nodes | collapse all nodes | view schema
WBMol:00004908 | Public_name | Dithiothreitol | ||||
---|---|---|---|---|---|---|
Formula | C4H10O2S2 | |||||
Monoisotopic_mass | 154.012 | |||||
IUPAC | rel-(2R,3R)-1,4-disulfanylbutane-2,3-diol | |||||
SMILES | OC(CS)C(O)CS | |||||
InChi | InChI=1S/C4H10O2S2/c5-3(1-7)4(6)2-8/h3-8H,1-2H2 | |||||
InChiKey | VHJLVAABSRFDPM-UHFFFAOYSA-N | |||||
Synonym | DTT | |||||
DB_info | Database (5) | |||||
WBProcess | WBbiopr:00000046 | |||||
WBbiopr:00000076 | ||||||
WBbiopr:00000079 | ||||||
Affects_phenotype_of | Variation (37) | |||||
RNAi | WBRNAi00093148 | WBPhenotype:0000031 | Paper_evidence | WBPaper00030999 | ||
WBRNAi00116064 | WBPhenotype:0001502 | Paper_evidence | WBPaper00063962 | |||
WBRNAi00116065 | WBPhenotype:0001502 | Paper_evidence | WBPaper00063962 | |||
WBRNAi00117203 | WBPhenotype:0001502 | Paper_evidence | WBPaper00064568 | |||
Disease_info | Induces_disease | DOID:14330 | ||||
Disease_model_inducer | WBDOannot00000464 | |||||
Interaction | WBInteraction000520512 | |||||
WBInteraction000536421 | ||||||
WBInteraction000536424 | ||||||
WBInteraction000541478 | ||||||
WBInteraction000541479 | ||||||
WBInteraction000541480 | ||||||
Molecule_use | ER-stress inducer | reducing agent that disrupts disulfide bond formation in the ER | |||||
Reference | WBPaper00005044 |