WormBase Tree Display for Molecule: WBMol:00004908
expand all nodes | collapse all nodes | view schema
WBMol:00004908 | Public_name | Dithiothreitol | |||
---|---|---|---|---|---|
Formula | C4H10O2S2 | ||||
Monoisotopic_mass | 154.012 | ||||
IUPAC | rel-(2R,3R)-1,4-disulfanylbutane-2,3-diol | ||||
SMILES | OC(CS)C(O)CS | ||||
InChi | InChI=1S/C4H10O2S2/c5-3(1-7)4(6)2-8/h3-8H,1-2H2 | ||||
InChiKey | VHJLVAABSRFDPM-UHFFFAOYSA-N | ||||
Synonym | DTT | ||||
DB_info | Database | NLM_MeSH | UID | D004229 | |
CTD | ChemicalID | D004229 | |||
ChEBI | CHEBI_ID | 18320 | |||
ChemIDplus | RN | 3483-12-3 | |||
KEGG COMPOUND | Accession_number | C00265 | |||
WBProcess | WBbiopr:00000046 | ||||
WBbiopr:00000076 | |||||
WBbiopr:00000079 | |||||
Affects_phenotype_of (2) | |||||
Disease_info | Induces_disease | DOID:14330 | |||
Disease_model_inducer | WBDOannot00000464 | ||||
Interaction | WBInteraction000520512 | ||||
WBInteraction000536421 | |||||
WBInteraction000536424 | |||||
WBInteraction000541478 | |||||
WBInteraction000541479 | |||||
WBInteraction000541480 | |||||
Molecule_use | ER-stress inducer | reducing agent that disrupts disulfide bond formation in the ER | ||||
Reference | WBPaper00005044 |