WormBase Tree Display for Molecule: WBMol:00005403
expand all nodes | collapse all nodes | view schema
| WBMol:00005403 | Public_name | DAPT | |||
|---|---|---|---|---|---|
| IUPAC | tert-butyl (2S)-({N-[(3,5-difluorophenyl)acetyl]-L-alanyl}amino)(phenyl)acetate | ||||
| SMILES | C[C@H](NC(=O)Cc1cc(F)cc(F)c1)C(=O)N[C@H](C(=O)OC(C)(C)C)c1ccccc1 | ||||
| InChi | InChI=1S/C23H26F2N2O4/c1-14(26-19(28)12-15-10-17(24)13-18(25)11-15)21(29)27-20(16-8-6-5-7-9-16)22(30)31-23(2,3)4/h5-11,13-14,20H,12H2,1-4H3,(H,26,28)(H,27,29)/t14-,20-/m0/s1 | ||||
| InChiKey | DWJXYEABWRJFSP-XOBRGWDASA-N | ||||
| Synonym | N-(N-(3,5-difluorophenacetyl)alanyl)phenylglycine tert-butyl ester | ||||
| DAPT butylester | |||||
| N-[N-(3,5-difluorophenacetyl)-L-alanyl]-S-phenylglycine t-butyl ester | |||||
| gamma-secretase inhibitor IX | |||||
| DB_info | Database | NLM_MeSH | UID | C419410 | |
| CTD | ChemicalID | C419410 | |||
| ChEBI | CHEBI_ID | 86193 | |||
| Molecule_use | potent inhibitor of gamma-secretase activity and Notch signaling (Geling et al., 2002) | ||||
| Reference | WBPaper00040714 |
