WormBase Tree Display for Molecule: WBMol:00005316
expand all nodes | collapse all nodes | view schema
WBMol:00005316 | Public_name | Beta-Ala-Lys-AMCA | |||
---|---|---|---|---|---|
IUPAC | beta-alanyl-N(6)-[(7-amino-4-methyl-2-oxo-2H-chromen-3-yl)acetyl]-L-lysine | ||||
SMILES | Cc1c(CC(=O)NCCCC[C@H](NC(=O)CCN)C(O)=O)c(=O)oc2cc(N)ccc12 | ||||
InChi | InChI=1S/C21H28N4O6/c1-12-14-6-5-13(23)10-17(14)31-21(30)15(12)11-19(27)24-9-3-2-4-16(20(28)29)25-18(26)7-8-22/h5-6,10,16H,2-4,7-9,11,22-23H2,1H3,(H,24,27)(H,25,26)(H,28,29)/t16-/m0/s1 | ||||
InChiKey | BXZFTTVQAOLWHY-INIZCTEOSA-N | ||||
Synonym | beta-Ala-Lys-N(epsilon)-AMCA | ||||
DB_info | Database | ChEBI | CHEBI_ID | 79309 | |
Affects_phenotype_of | RNAi (167) | ||||
Molecule_use | Beta-Ala-Lys-AMCA is a fluorescent dipeptide used to assess dipeptide uptake across membranes, for example by peptide transporters in the intestine or brain | ||||
Reference | WBPaper00040287 |