WormBase Tree Display for Molecule: WBMol:00003650
expand all nodes | collapse all nodes | view schema
WBMol:00003650 | Public_name | aldicarb | ||||
---|---|---|---|---|---|---|
Formula | C7H14N2O2S | |||||
Monoisotopic_mass | 190.078 | |||||
IUPAC | 2-methyl-N-[(methylcarbamoyl)oxy]-2-(methylsulfanyl)propan-1-imine | |||||
SMILES | [H]C(=NOC(=O)NC)C(C)(C)SC | |||||
InChi | InChI=1S/C7H14N2O2S/c1-7(2,12-4)5-9-11-6(10)8-3/h5H,1-4H3,(H,8,10) | |||||
InChiKey | QGLZXHRNAYXIBU-UHFFFAOYSA-N | |||||
Synonym (12) | ||||||
DB_info | Database | NLM_MeSH | UID | D000448 | ||
CTD | ChemicalID | D000448 | ||||
ChEBI | CHEBI_ID | 2555 | ||||
ChemIDplus | RN | 116-06-3 | ||||
KEGG COMPOUND | Accession_number | C11015 | ||||
Biofunction_role | Inhibitor | Paper_evidence | WBPaper00039786 | |||
WBPaper00000464 | ||||||
WBPaper00040375 | ||||||
WBPaper00002167 | ||||||
WBPaper00053832 | ||||||
Remark | inhibits the enzyme that breaks down acetylcholine thereby activating cholinergic receptors | |||||
Regulate_expr_cluster | WBPaper00038061:aldicarb_downregulated | |||||
WBPaper00038061:aldicarb_upregulated | ||||||
Affects_phenotype_of | Variation (169) | |||||
Transgene (16) | ||||||
RNAi | WBRNAi00082243 | WBPhenotype:0000016 | Paper_evidence | WBPaper00036228 | ||
WBRNAi00095152 | WBPhenotype:0000017 | Paper_evidence | WBPaper00036653 | |||
WBRNAi00095153 | WBPhenotype:0000017 | Paper_evidence | WBPaper00036653 | |||
WBRNAi00117277 | WBPhenotype:0000016 | Paper_evidence | WBPaper00064672 | |||
Disease_info (2) | ||||||
Molecule_use | acetylcholinesterase inhibitor | insecticide | acaricide | nematocide | |||||
Reference | WBPaper00039786 | |||||
WBPaper00000464 | ||||||
WBPaper00040375 | ||||||
WBPaper00002167 | ||||||
WBPaper00053832 |