WormBase Tree Display for Molecule: WBMol:00005361
expand all nodes | collapse all nodes | view schema
WBMol:00005361 | Public_name | ethidium bromide | ||||
---|---|---|---|---|---|---|
Formula | C21H20BrN3 | |||||
Monoisotopic_mass | 393.084 | |||||
IUPAC | 3,8-diamino-5-ethyl-6-phenylphenanthridinium bromide | |||||
SMILES | [Br-].CC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc12 | |||||
InChi | InChI=1S/C21H19N3.BrH/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14;/h3-13,23H,2,22H2,1H3;1H | |||||
InChiKey | ZMMJGEGLRURXTF-UHFFFAOYSA-N | |||||
Synonym | EtBr | |||||
Ethidium bromide | ||||||
DB_info | Database | ChEBI | CHEBI_ID | 4883 | ||
ChemIDplus | RN | 1239-45-8 | ||||
KEGG COMPOUND | Accession_number | C11161 | ||||
WBProcess (2) | ||||||
Affects_phenotype_of | Variation | WBVar00249879 | WBPhenotype:0000010 | Paper_evidence | WBPaper00042063 | |
Curator_confirmed | WBPerson937 | |||||
WBVar00601112 | WBPhenotype:0001918 | Paper_evidence | WBPaper00042171 | |||
Curator_confirmed | WBPerson2987 | |||||
WBVar01474242 | WBPhenotype:0001502 | Paper_evidence | WBPaper00042171 | |||
Curator_confirmed | WBPerson2987 | |||||
Strain | WBStrain00000001 | WBPhenotype:0000140 | Paper_evidence | WBPaper00041209 | ||
Curator_confirmed | WBPerson712 | |||||
RNAi | WBRNAi00093166 | WBPhenotype:0001278 | Paper_evidence | WBPaper00031084 | ||
Interaction | WBInteraction000501550 | |||||
WBInteraction000501552 | ||||||
WBInteraction000501553 | ||||||
WBInteraction000520528 | ||||||
WBInteraction000537382 | ||||||
WBInteraction000537425 | ||||||
WBInteraction000537534 | ||||||
Molecule_use | Preferential impairment of mitochondrial DNA replication and transcription. | Activation of the Mitochondrial UPR response | |||||
Reference | WBPaper00024269 | |||||
WBPaper00045078 | ||||||
WBPaper00041209 |