WormBase Tree Display for Molecule: WBMol:00003650
expand all nodes | collapse all nodes | view schema
WBMol:00003650 | Public_name | aldicarb | |||
---|---|---|---|---|---|
Formula | C7H14N2O2S | ||||
Monoisotopic_mass | 190.078 | ||||
IUPAC | 2-methyl-N-[(methylcarbamoyl)oxy]-2-(methylsulfanyl)propan-1-imine | ||||
SMILES | [H]C(=NOC(=O)NC)C(C)(C)SC | ||||
InChi | InChI=1S/C7H14N2O2S/c1-7(2,12-4)5-9-11-6(10)8-3/h5H,1-4H3,(H,8,10) | ||||
InChiKey | QGLZXHRNAYXIBU-UHFFFAOYSA-N | ||||
Synonym (12) | |||||
DB_info | Database | NLM_MeSH | UID | D000448 | |
CTD | ChemicalID | D000448 | |||
ChEBI | CHEBI_ID | 2555 | |||
ChemIDplus | RN | 116-06-3 | |||
KEGG COMPOUND | Accession_number | C11015 | |||
Biofunction_role | Inhibitor | Paper_evidence | WBPaper00039786 | ||
WBPaper00000464 | |||||
WBPaper00040375 | |||||
WBPaper00002167 | |||||
WBPaper00053832 | |||||
Remark | inhibits the enzyme that breaks down acetylcholine thereby activating cholinergic receptors | ||||
Regulate_expr_cluster (2) | |||||
Affects_phenotype_of | Variation (169) | ||||
Transgene (16) | |||||
RNAi (4) | |||||
Disease_info | Induces_disease | DOID:700 | |||
DOID:10595 | |||||
DOID:11724 | |||||
DOID:0050709 | |||||
DOID:0060041 | |||||
Disease_model_inducer (14) | |||||
Molecule_use | acetylcholinesterase inhibitor | insecticide | acaricide | nematocide | ||||
Reference | WBPaper00039786 | ||||
WBPaper00000464 | |||||
WBPaper00040375 | |||||
WBPaper00002167 | |||||
WBPaper00053832 |